EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C50H80N8O11 |
| Net Charge | 0 |
| Average Mass | 969.235 |
| Monoisotopic Mass | 968.59466 |
| SMILES | CC[C@H](C)[C@@H]1OC(=O)[C@@H](C)[C@@H](CC)NC(=O)[C@H](C)N(C)C(=O)C(C)(C)C(=O)[C@H](C)NC(=O)[C@H](Cc2ccccc2)N(C)C(=O)[C@H](C(C)C)N(C)C(=O)CNC(=O)[C@H](CC(C)C)N(C)C(=O)CNC1=O |
| InChI | InChI=1S/C50H80N8O11/c1-17-30(7)41-46(65)52-26-38(59)56(14)36(24-28(3)4)44(63)51-27-39(60)58(16)40(29(5)6)47(66)57(15)37(25-34-22-20-19-21-23-34)45(64)53-32(9)42(61)50(11,12)49(68)55(13)33(10)43(62)54-35(18-2)31(8)48(67)69-41/h19-23,28-33,35-37,40-41H,17-18,24-27H2,1-16H3,(H,51,63)(H,52,65)(H,53,64)(H,54,62)/t30-,31-,32-,33-,35+,36-,37-,40-,41-/m0/s1 |
| InChIKey | MLDFWFKDAWCBSV-JXVYMESPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Leptolyngbya species RS03 (ncbitaxon:1009459) | - | PubMed (21806012) | Crude organic extract of Leptolyngbya sp.RS03 collected from the Red Sea shipwreck SS Thistlegorm |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dolastatin 12 (CHEBI:69192) has role metabolite (CHEBI:25212) |
| Dolastatin 12 (CHEBI:69192) is a cyclodepsipeptide (CHEBI:35213) |
| Registry Numbers | Sources |
|---|---|
| CAS:122054-77-7 | ChemIDplus |
| Citations |
|---|