EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:6919 - mezlocillin
| Formula | C21H25N5O8S2 |
| Net Charge | 0 |
| Average Mass | 539.592 |
| Monoisotopic Mass | 539.11445 |
| SMILES | [H][C@]12SC(C)(C)[C@H](C(=O)O)N1C(=O)[C@H]2NC(=O)[C@H](NC(=O)N1CCN(S(C)(=O)=O)C1=O)c1ccccc1 |
| InChI | InChI=1S/C21H25N5O8S2/c1-21(2)14(18(29)30)26-16(28)13(17(26)35-21)22-15(27)12(11-7-5-4-6-8-11)23-19(31)24-9-10-25(20(24)32)36(3,33)34/h4-8,12-14,17H,9-10H2,1-3H3,(H,22,27)(H,23,31)(H,29,30)/t12-,13-,14+,17-/m1/s1 |
| InChIKey | YPBATNHYBCGSSN-VWPFQQQWSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mezlocillin (CHEBI:6919) has role antibacterial drug (CHEBI:36047) |
| mezlocillin (CHEBI:6919) is a penicillin (CHEBI:17334) |
| mezlocillin (CHEBI:6919) is a penicillin allergen (CHEBI:88187) |
| mezlocillin (CHEBI:6919) is conjugate acid of mezlocillin(1−) (CHEBI:52066) |
| Incoming Relation(s) |
| mezlocillin(1−) (CHEBI:52066) is conjugate base of mezlocillin (CHEBI:6919) |
| IUPAC Name |
|---|
| 6β-{(2R)-2-[3-(methanesulfonyl)-2-oxoimidazolidine-1-carboxamido]-2-phenylacetamido}-2,2-dimethylpenam-3α-carboxylic acid |
| INNs | Source |
|---|---|
| mezlocillin | KEGG DRUG |
| mezlocilina | ChemIDplus |
| mezlocilline | ChemIDplus |
| mezlocillinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| Mezlin | KEGG COMPOUND |
| Mezlocillin | KEGG COMPOUND |
| (2S,5R,6R)-3,3-dimethyl-6-{[(2R)-2-({[3-(methylsulfonyl)-2-oxoimidazolidin-1-yl]carbonyl}amino)-2-phenylacetyl]amino}-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid | IUPAC |
| 6β-{(2R)-2-[3-(methanesulfonyl)-2-oxoimidazolidine-1-carboxamido]-2-phenylacetamido}penicillanic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C07221 | KEGG COMPOUND |
| D05021 | KEGG DRUG |
| DE2152967 | Patent |
| US3974142 | Patent |
| DB00948 | DrugBank |
| Mezlocillin | Wikipedia |
| 1795 | DrugCentral |
| CN101585845 | Patent |
| CN101328187 | Patent |
| CN1485035 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6081499 | Reaxys |
| CAS:51481-65-3 | KEGG COMPOUND |
| CAS:51481-65-3 | ChemIDplus |
| Citations |
|---|