EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H38O2 |
| Net Charge | 0 |
| Average Mass | 298.511 |
| Monoisotopic Mass | 298.28718 |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)OC |
| InChI | InChI=1S/C19H38O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h3-18H2,1-2H3 |
| InChIKey | HPEUJPJOZXNMSJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brassica napus (ncbitaxon:3708) | - | MetaboLights (MTBLS309) | From MetaboLights |
| Homo sapiens (ncbitaxon:9606) | faeces (UBERON:0001988) | PubMed (24029555) | |
| Mus musculus (ncbitaxon:10090) | - | MetaboLights (MTBLS345) | From MetaboLights |
| Neolitsea daibuensis (IPNI:466954-1) | root (BTO:0001188) | PubMed (22148193) | Cold MeOH extract of dried root, obtained as a mixture of methyl palmitate and methyl stearate |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Methyl stearate (CHEBI:69188) has role metabolite (CHEBI:25212) |
| Methyl stearate (CHEBI:69188) is a fatty acid methyl ester (CHEBI:4986) |
| Methyl stearate (CHEBI:69188) is a octadecanoate ester (CHEBI:75925) |
| IUPAC Name |
|---|
| methyl octadecanoate |
| Synonyms | Source |
|---|---|
| Kemester 4516 | HMDB |
| Kemester 9018 | HMDB |
| Kemester 9718 | HMDB |
| Metholene 2218 | HMDB |
| Methyl ester of octadecanoic acid | HMDB |
| Methyl N-octadecanoate | HMDB |
| Manual Xrefs | Databases |
|---|---|
| 0000112618 | ChemIDplus |
| C00030759 | KNApSAcK |
| HMDB0034154 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:112-61-8 | KEGG COMPOUND |
| Citations |
|---|