EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H34O2 |
| Net Charge | 0 |
| Average Mass | 270.457 |
| Monoisotopic Mass | 270.25588 |
| SMILES | CCCCCCCCCCCCCCCC(=O)OC |
| InChI | InChI=1S/C17H34O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18)19-2/h3-16H2,1-2H3 |
| InChIKey | FLIACVVOZYBSBS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Neolitsea daibuensis (IPNI:466954-1) | root (BTO:0001188) | PubMed (22148193) | Cold MeOH extract of dried root, obtained as a mixture of methyl palmitate and methyl stearate |
| Homo sapiens (ncbitaxon:9606) | |||
| saliva (UBERON:0001836) | PubMed (24421258) | ||
| - | MetaboLights (MTBLS191) | From MetaboLights |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Methyl palmitate (CHEBI:69187) has role metabolite (CHEBI:25212) |
| Methyl palmitate (CHEBI:69187) is a fatty acid methyl ester (CHEBI:4986) |
| Synonyms | Source |
|---|---|
| Methyl hexadecanoate | ChEBI |
| Methyl palmitate | HMDB |
| Hexadecanoic acid methyl ester | HMDB |
| Methyl palmitic acid | HMDB |
| methyl hexadecanoate | HMDB |
| Hexadecanoate methyl ester | HMDB |
| Manual Xrefs | Databases |
|---|---|
| 0000112390 | ChemIDplus |
| C16995 | KEGG COMPOUND |
| HMDB0061859 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:112-39-0 | KEGG COMPOUND |
| Citations |
|---|