EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16O5 |
| Net Charge | 0 |
| Average Mass | 252.266 |
| Monoisotopic Mass | 252.09977 |
| SMILES | [H][C@]12C=C(C)C(=O)[C@@]1(O)[C@@]1(O)C(=O)O[C@@](C)(C2)[C@H]1C |
| InChI | InChI=1S/C13H16O5/c1-6-4-8-5-11(3)7(2)12(16,10(15)18-11)13(8,17)9(6)14/h4,7-8,16-17H,5H2,1-3H3/t7-,8-,11+,12+,13-/m1/s1 |
| InChIKey | NPMJPMBCGOWCAJ-NNXOGTOISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sarocladium strictum (ncbitaxon:5046) | - | PubMed (22136576) | EtOAc extract of culture broth inoculated with spores (incubated for 3 weeks) Strain: MB05005 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Acremostrictin, rel- (CHEBI:69186) has role metabolite (CHEBI:25212) |
| Acremostrictin, rel- (CHEBI:69186) is a γ-lactone (CHEBI:37581) |
| Citations |
|---|