EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H34O6 |
| Net Charge | 0 |
| Average Mass | 418.530 |
| Monoisotopic Mass | 418.23554 |
| SMILES | [H][C@]12/C=C/CCC[C@@H](C)OC(=O)/C=C\C=C\C[C@@H](O)/C=C/C=C\C[C@H](C[C@@H](O)[C@H]1O)O2 |
| InChI | InChI=1S/C24H34O6/c1-18-11-5-2-9-15-22-24(28)21(26)17-20(30-22)14-8-3-6-12-19(25)13-7-4-10-16-23(27)29-18/h3-4,6-10,12,15-16,18-22,24-26,28H,2,5,11,13-14,17H2,1H3/b7-4+,8-3-,12-6+,15-9+,16-10-/t18-,19+,20-,21-,22+,24-/m1/s1 |
| InChIKey | CTOADWSMRKKIPA-IOCDPXODSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bacillus sp. (ncbitaxon:1409) | - | PubMed (22133265) | Ethyl acetate extract of marine[low salinity(12g/L)] Bacillus sp. Strain: 09ID194 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 13,17-Epoxy-16-hydroxy macrolactin A (CHEBI:69184) has role metabolite (CHEBI:25212) |
| 13,17-Epoxy-16-hydroxy macrolactin A (CHEBI:69184) is a macrolide (CHEBI:25106) |
| Citations |
|---|