EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H48O14 |
| Net Charge | 0 |
| Average Mass | 776.832 |
| Monoisotopic Mass | 776.30441 |
| SMILES | [H][C@@]12[C@H](OC(C)=O)[C@@]3(C)O[C@@]4([C@@H]3OC(=O)c3ccccc3)[C@@H](OC(C)=O)[C@@H](C)C[C@@]4([H])[C@@]1(O)[C@H](C)[C@H](OC(C)=O)[C@@](OC(=O)c1ccccc1)(C(=C)C)[C@@H]2OC(C)=O |
| InChI | InChI=1S/C42H48O14/c1-21(2)41(55-37(48)29-18-14-11-15-19-29)33(51-25(6)44)23(4)40(49)30-20-22(3)32(50-24(5)43)42(30)38(54-36(47)28-16-12-10-13-17-28)39(9,56-42)34(52-26(7)45)31(40)35(41)53-27(8)46/h10-19,22-23,30-35,38,49H,1,20H2,2-9H3/t22-,23+,30-,31-,32-,33-,34-,35+,38+,39+,40-,41-,42+/m0/s1 |
| InChIKey | USLNOOFCHMVHFV-CXQXIBKHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trigonostemon heterophyllus (IPNI:358015-1) | twig (BTO:0001411) | PubMed (22122667) | 95% EtOH extract of powdered and air-dried twigs |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trigochinin B (CHEBI:69180) has role metabolite (CHEBI:25212) |
| trigochinin B (CHEBI:69180) is a diterpenoid (CHEBI:23849) |
| Citations |
|---|