EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O2 |
| Net Charge | 0 |
| Average Mass | 304.474 |
| Monoisotopic Mass | 304.24023 |
| SMILES | [H][C@@]12CCC3=C[C@@](C)(C=C)CC[C@]3(O)[C@@]1(C)[C@@H](O)CCC2(C)C |
| InChI | InChI=1S/C20H32O2/c1-6-18(4)11-12-20(22)14(13-18)7-8-15-17(2,3)10-9-16(21)19(15,20)5/h6,13,15-16,21-22H,1,7-12H2,2-5H3/t15-,16-,18-,19+,20+/m0/s1 |
| InChIKey | NSRIQLOVXVWUAB-FLFBIERCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trigonostemon heterophyllus (IPNI:358015-1) | twig (BTO:0001411) | PubMed (22122667) | 95% EtOH extract of powdered and air-dried twigs |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sandaracopimaradiene-1alpha,9alpha-diol (CHEBI:69179) has role metabolite (CHEBI:25212) |
| sandaracopimaradiene-1alpha,9alpha-diol (CHEBI:69179) is a diol (CHEBI:23824) |
| sandaracopimaradiene-1alpha,9alpha-diol (CHEBI:69179) is a tricyclic diterpenoid (CHEBI:79084) |
| Citations |
|---|