EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H24O2 |
| Net Charge | 0 |
| Average Mass | 272.388 |
| Monoisotopic Mass | 272.17763 |
| SMILES | [H][C@@]12CCc3cc(C)c(O)cc3C=C1CC[C@H](O)C2(C)C |
| InChI | InChI=1S/C18H24O2/c1-11-8-12-4-6-15-13(9-14(12)10-16(11)19)5-7-17(20)18(15,2)3/h8-10,15,17,19-20H,4-7H2,1-3H3/t15-,17+/m1/s1 |
| InChIKey | LLUGDEYQSVTJSI-WBVHZDCISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trigonostemon heterophyllus (IPNI:358015-1) | twig (BTO:0001411) | PubMed (22122667) | 95% EtOH extract of powdered and air-dried twigs |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,2-dihydroheudelotinol (CHEBI:69178) has role metabolite (CHEBI:25212) |
| 1,2-dihydroheudelotinol (CHEBI:69178) is a hydroxytoluene (CHEBI:24751) |
| Citations |
|---|