EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O2 |
| Net Charge | 0 |
| Average Mass | 306.490 |
| Monoisotopic Mass | 306.25588 |
| SMILES | [H][C@@]12CCC(=C)[C@H](CC[C@@](C)(O)C=C)[C@@]1(C)CCCC2(C)CO |
| InChI | InChI=1S/C20H34O2/c1-6-19(4,22)13-10-16-15(2)8-9-17-18(3,14-21)11-7-12-20(16,17)5/h6,16-17,21-22H,1-2,7-14H2,3-5H3/t16-,17-,18?,19-,20+/m0/s1 |
| InChIKey | IERFAZQCIAZODG-XIBWBMNSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trigonostemon heterophyllus (IPNI:358015-1) | twig (BTO:0001411) | PubMed (22122667) | 95% EtOH extract of powdered and air-dried twigs |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 18-hydroxymanool (CHEBI:69177) has role metabolite (CHEBI:25212) |
| 18-hydroxymanool (CHEBI:69177) is a diterpenoid (CHEBI:23849) |
| Synonym | Source |
|---|---|
| Labda-8(20),14-diene-13,19-diol | ChEBI |
| Citations |
|---|