EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28O3 |
| Net Charge | 0 |
| Average Mass | 328.452 |
| Monoisotopic Mass | 328.20384 |
| SMILES | [H][C@]1(C(=C)C)CCc2c(cc(O)c(C)c2C=C)[C@]1(C)CCC(=O)OC |
| InChI | InChI=1S/C21H28O3/c1-7-15-14(4)19(22)12-18-16(15)8-9-17(13(2)3)21(18,5)11-10-20(23)24-6/h7,12,17,22H,1-2,8-11H2,3-6H3/t17-,21-/m1/s1 |
| InChIKey | CXOXYGZFBDGZJN-DYESRHJHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trigonostemon heterophyllus (IPNI:358015-1) | twig (BTO:0001411) | PubMed (22122667) | 95% EtOH extract of powdered and air-dried twigs |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4-seco-sonderianol (CHEBI:69176) has role metabolite (CHEBI:25212) |
| 3,4-seco-sonderianol (CHEBI:69176) is a tetralins (CHEBI:36786) |
| Synonym | Source |
|---|---|
| methyl 3-[(1R,2R)-5-ethenyl-7-hydroxy-1,6-dimethyl-2-prop-1-en-2-yl-3,4-dihydro-2H-naphthalen-1-yl]propanoate | ChEBI |
| Citations |
|---|