EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O4 |
| Net Charge | 0 |
| Average Mass | 334.456 |
| Monoisotopic Mass | 334.21441 |
| SMILES | [H][C@@]1([C@@](C)(O)CC/C=C(\C)C(O)C(=O)C=C(C)C)CCC(C)=CC1=O |
| InChI | InChI=1S/C20H30O4/c1-13(2)11-18(22)19(23)15(4)7-6-10-20(5,24)16-9-8-14(3)12-17(16)21/h7,11-12,16,19,23-24H,6,8-10H2,1-5H3/b15-7+/t16-,19?,20+/m1/s1 |
| InChIKey | MMCHYQXMIUOBDF-IIZIGAGWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trigonostemon heterophyllus (IPNI:358015-1) | twig (BTO:0001411) | PubMed (22122667) | 95% EtOH extract of powdered and air-dried twigs |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trigohetone, (rel)- (CHEBI:69175) has role metabolite (CHEBI:25212) |
| trigohetone, (rel)- (CHEBI:69175) is a sesquiterpenoid (CHEBI:26658) |
| Citations |
|---|