EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26O3 |
| Net Charge | 0 |
| Average Mass | 302.414 |
| Monoisotopic Mass | 302.18819 |
| SMILES | [H][C@]1(C(=C)C)CCc2cc(C)c(O)cc2[C@]1(C)CCC(=O)OC |
| InChI | InChI=1S/C19H26O3/c1-12(2)15-7-6-14-10-13(3)17(20)11-16(14)19(15,4)9-8-18(21)22-5/h10-11,15,20H,1,6-9H2,2-5H3/t15-,19-/m1/s1 |
| InChIKey | ZKQCHMDFCJRXNI-DNVCBOLYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trigonostemon heterophyllus (IPNI:358015-1) | twig (BTO:0001411) | PubMed (22122667) | 95% EtOH extract of powdered and air-dried twigs |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trigoheteric acid methyl ester, (rel)- (CHEBI:69174) has role metabolite (CHEBI:25212) |
| trigoheteric acid methyl ester, (rel)- (CHEBI:69174) is a tetralins (CHEBI:36786) |
| Synonym | Source |
|---|---|
| rel-15,16-dinor-3,4-seco-sonderianol | ChEBI |
| Citations |
|---|