EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H44O11 |
| Net Charge | 0 |
| Average Mass | 616.704 |
| Monoisotopic Mass | 616.28836 |
| SMILES | [H][C@@]12C[C@H](C)[C@H](OC(C)=O)[C@@]1(O)[C@H](O)[C@](C)(O)[C@@H](O)[C@@]1([H])[C@@]3([H])OC4(C)O[C@@]21[C@H](C)[C@H](OC(=O)CCc1ccccc1)[C@]3(C(=C)C)O4 |
| InChI | InChI=1S/C33H44O11/c1-16(2)32-26(41-22(35)14-13-20-11-9-8-10-12-20)18(4)33-21-15-17(3)25(40-19(5)34)31(21,39)28(37)29(6,38)24(36)23(33)27(32)42-30(7,43-32)44-33/h8-12,17-18,21,23-28,36-39H,1,13-15H2,2-7H3/t17-,18+,21+,23-,24-,25-,26-,27+,28+,29+,30?,31+,32-,33-/m0/s1 |
| InChIKey | QQXREVRDDYMTOR-BMFITTSNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trigonostemon heterophyllus (IPNI:358015-1) | twig (BTO:0001411) | PubMed (22122667) | 95% EtOH extract of powdered and air-dried twigs |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trigoheterin D, (rel)- (CHEBI:69172) has role metabolite (CHEBI:25212) |
| trigoheterin D, (rel)- (CHEBI:69172) is a diterpenoid (CHEBI:23849) |
| Citations |
|---|