EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H41N5O5 |
| Net Charge | 0 |
| Average Mass | 575.710 |
| Monoisotopic Mass | 575.31077 |
| SMILES | [H][C@@]12C(=O)N[C@@H](Cc3ccccc3)C(=O)N/C=C\c3ccc(cc3)O[C@@]1([H])CCN2C(=O)[C@@H](NC(=O)[C@H](C)N(C)C)C(C)C |
| InChI | InChI=1S/C32H41N5O5/c1-20(2)27(35-29(38)21(3)36(4)5)32(41)37-18-16-26-28(37)31(40)34-25(19-23-9-7-6-8-10-23)30(39)33-17-15-22-11-13-24(42-26)14-12-22/h6-15,17,20-21,25-28H,16,18-19H2,1-5H3,(H,33,39)(H,34,40)(H,35,38)/b17-15-/t21-,25-,26-,27-,28-/m0/s1 |
| InChIKey | OGCOHPMZUTVUAD-NHFZPNTRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ziziphus apetala (ncbitaxon:478035) | root (BTO:0001188) | PubMed (22148241) | MeOH extract of Air-dried and powdered roots |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mauritine A (CHEBI:69167) has role metabolite (CHEBI:25212) |
| mauritine A (CHEBI:69167) is a cyclic peptide (CHEBI:23449) |
| Citations |
|---|