EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H39N5O6 |
| Net Charge | 0 |
| Average Mass | 589.693 |
| Monoisotopic Mass | 589.29003 |
| SMILES | [H][C@@]12C(=O)N[C@@H](Cc3ccccc3)C(=O)N/C=C\c3ccc(cc3)O[C@@]1([H])CCN2C(=O)[C@@H](NC(=O)C(C)N(C)C=O)C(C)C |
| InChI | InChI=1S/C32H39N5O6/c1-20(2)27(35-29(39)21(3)36(4)19-38)32(42)37-17-15-26-28(37)31(41)34-25(18-23-8-6-5-7-9-23)30(40)33-16-14-22-10-12-24(43-26)13-11-22/h5-14,16,19-21,25-28H,15,17-18H2,1-4H3,(H,33,40)(H,34,41)(H,35,39)/b16-14-/t21?,25-,26-,27-,28-/m0/s1 |
| InChIKey | VTDPXBHEENTWPJ-GKUFJQKTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ziziphus apetala (ncbitaxon:478035) | stem (BTO:0001300) | PubMed (22148241) | 95% EtOH extract of Air-dried and powdered stems |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Apetaline C (CHEBI:69166) has role metabolite (CHEBI:25212) |
| Apetaline C (CHEBI:69166) is a cyclic peptide (CHEBI:23449) |
| Citations |
|---|