EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H41N5O6 |
| Net Charge | 0 |
| Average Mass | 591.709 |
| Monoisotopic Mass | 591.30568 |
| SMILES | [H][C@@]12C(=O)N[C@@H](Cc3ccccc3)C(=O)N/C=C\c3ccc(cc3)O[C@@]1([H])CCN2C(=O)[C@@H](NC(=O)[C@@H](C)[N+](C)(C)[O-])C(C)C |
| InChI | InChI=1S/C32H41N5O6/c1-20(2)27(35-29(38)21(3)37(4,5)42)32(41)36-18-16-26-28(36)31(40)34-25(19-23-9-7-6-8-10-23)30(39)33-17-15-22-11-13-24(43-26)14-12-22/h6-15,17,20-21,25-28H,16,18-19H2,1-5H3,(H,33,39)(H,34,40)(H,35,38)/b17-15-/t21-,25+,26+,27+,28+/m1/s1 |
| InChIKey | MWQUPAZWQQWEPK-FADZAQNWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ziziphus apetala (ncbitaxon:478035) | stem (BTO:0001300) | PubMed (22148241) | 95% EtOH extract of Air-dried and powdered stems |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Epimauritine A N-oxide (CHEBI:69164) has role metabolite (CHEBI:25212) |
| Epimauritine A N-oxide (CHEBI:69164) is a cyclic peptide (CHEBI:23449) |
| Epimauritine A N-oxide (CHEBI:69164) is a tertiary amine oxide (CHEBI:134363) |
| Citations |
|---|