EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H10N4O3 |
| Net Charge | 0 |
| Average Mass | 210.193 |
| Monoisotopic Mass | 210.07529 |
| SMILES | Cn1c(=O)c2c(nc(=O)n2C)n(C)c1=O |
| InChI | InChI=1S/C8H10N4O3/c1-10-4-5(9-7(10)14)11(2)8(15)12(3)6(4)13/h1-3H3,(H,9,14) |
| InChIKey | BYXCFUMGEBZDDI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| urine (BTO:0001419) | PubMed (15537072) | ||
| blood serum (BTO:0000133) | MetaboLights (MTBLS90) | ||
| - | MetaboLights (MTBLS93) | From MetaboLights | |
| - | MetaboLights (MTBLS90) | From MetaboLights | |
| - | MetaboLights (MTBLS124) | From MetaboLights | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,3,7-trimethyluric acid (CHEBI:691622) has role human blood serum metabolite (CHEBI:85234) |
| 1,3,7-trimethyluric acid (CHEBI:691622) has role human urinary metabolite (CHEBI:84087) |
| 1,3,7-trimethyluric acid (CHEBI:691622) has role human xenobiotic metabolite (CHEBI:76967) |
| 1,3,7-trimethyluric acid (CHEBI:691622) has role mouse metabolite (CHEBI:75771) |
| 1,3,7-trimethyluric acid (CHEBI:691622) is a oxopurine (CHEBI:25810) |
| 1,3,7-trimethyluric acid (CHEBI:691622) is conjugate acid of 1,3,7-trimethylurate (CHEBI:132940) |
| Incoming Relation(s) |
| 1,3,7-trimethylurate (CHEBI:132940) is conjugate base of 1,3,7-trimethyluric acid (CHEBI:691622) |
| IUPAC Name |
|---|
| 1,3,7-trimethyl-7,9-dihydro-1H-purine-2,6,8(3H)-trione |
| Synonyms | Source |
|---|---|
| 1,3,7-trimethyl-2,3,6,7,8,9-hexahydro-1H-purine-2,6,8-trione | IUPAC |
| 1,3,7-trimethylurate | ChemIDplus |
| 1,3,7-trimethyluric acid | ChemIDplus |
| 7,9-dihydro-1,3,7-trimethyl-1H-purine-2,6,8(3H)-trione | ChemIDplus |
| 8-oxocaffeine | ChEBI |
| 8-oxy-caffeine | ChEBI |
| UniProt Name | Source |
|---|---|
| 1,3,7-trimethylurate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 1,3,7-Trimethyluric_acid | Wikipedia |
| 71754 | ChemSpider |
| C00051957 | KNApSAcK |
| C16361 | KEGG COMPOUND |
| CPD-12480 | MetaCyc |
| EXU | PDBeChem |
| FDB022854 | FooDB |
| HMDB0002123 | HMDB |
| Citations |
|---|