EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H10N4O3 |
| Net Charge | 0 |
| Average Mass | 210.193 |
| Monoisotopic Mass | 210.07529 |
| SMILES | Cn1c(=O)c2c(nc(=O)n2C)n(C)c1=O |
| InChI | InChI=1S/C8H10N4O3/c1-10-4-5(9-7(10)14)11(2)8(15)12(3)6(4)13/h1-3H3,(H,9,14) |
| InChIKey | BYXCFUMGEBZDDI-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| urine (BTO:0001419) | PubMed (15537072) | ||
| blood serum (BTO:0000133) | MetaboLights (MTBLS90) | ||
| - | MetaboLights (MTBLS93) | From MetaboLights | |
| - | MetaboLights (MTBLS90) | From MetaboLights | |
| - | MetaboLights (MTBLS124) | From MetaboLights | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,3,7-trimethyluric acid (CHEBI:691622) has role human blood serum metabolite (CHEBI:85234) |
| 1,3,7-trimethyluric acid (CHEBI:691622) has role human urinary metabolite (CHEBI:84087) |
| 1,3,7-trimethyluric acid (CHEBI:691622) has role human xenobiotic metabolite (CHEBI:76967) |
| 1,3,7-trimethyluric acid (CHEBI:691622) has role mouse metabolite (CHEBI:75771) |
| 1,3,7-trimethyluric acid (CHEBI:691622) is a oxopurine (CHEBI:25810) |
| 1,3,7-trimethyluric acid (CHEBI:691622) is conjugate acid of 1,3,7-trimethylurate (CHEBI:132940) |
| Incoming Relation(s) |
| 1,3,7-trimethylurate (CHEBI:132940) is conjugate base of 1,3,7-trimethyluric acid (CHEBI:691622) |
| IUPAC Name |
|---|
| 1,3,7-trimethyl-7,9-dihydro-1H-purine-2,6,8(3H)-trione |
| Synonyms | Source |
|---|---|
| 1,3,7-trimethyl-2,3,6,7,8,9-hexahydro-1H-purine-2,6,8-trione | IUPAC |
| 1,3,7-trimethylurate | ChemIDplus |
| 1,3,7-trimethyluric acid | ChemIDplus |
| 7,9-dihydro-1,3,7-trimethyl-1H-purine-2,6,8(3H)-trione | ChemIDplus |
| 8-oxocaffeine | ChEBI |
| 8-oxy-caffeine | ChEBI |
| UniProt Name | Source |
|---|---|
| 1,3,7-trimethylurate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 1,3,7-Trimethyluric_acid | Wikipedia |
| 71754 | ChemSpider |
| C00051957 | KNApSAcK |
| C16361 | KEGG COMPOUND |
| CPD-12480 | MetaCyc |
| EXU | PDBeChem |
| FDB022854 | FooDB |
| HMDB0002123 | HMDB |
| Citations |
|---|