EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H39N5O5 |
| Net Charge | 0 |
| Average Mass | 573.694 |
| Monoisotopic Mass | 573.29512 |
| SMILES | [H][C@@]12C(=O)N[C@@H](Cc3ccccc3)C(=O)N/C=C\c3ccc(cc3)O[C@@]1([H])CCN2C(=O)[C@H](C(C)C)N1CN(C)[C@@H](C)C1=O |
| InChI | InChI=1S/C32H39N5O5/c1-20(2)27(37-19-35(4)21(3)31(37)40)32(41)36-17-15-26-28(36)30(39)34-25(18-23-8-6-5-7-9-23)29(38)33-16-14-22-10-12-24(42-26)13-11-22/h5-14,16,20-21,25-28H,15,17-19H2,1-4H3,(H,33,38)(H,34,39)/b16-14-/t21-,25-,26-,27-,28-/m0/s1 |
| InChIKey | NHMXYUDLGWLVHY-DYLSSQNPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ziziphus apetala (ncbitaxon:478035) | stem (BTO:0001300) | PubMed (22148241) | 95% EtOH extract of Air-dried and powdered stems |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Apetaline B (CHEBI:69162) has role metabolite (CHEBI:25212) |
| Apetaline B (CHEBI:69162) is a cyclic peptide (CHEBI:23449) |
| Citations |
|---|