EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H35N5O6 |
| Net Charge | 0 |
| Average Mass | 561.639 |
| Monoisotopic Mass | 561.25873 |
| SMILES | [H][C@@]12C(=O)N[C@@H](Cc3ccccc3)C(=O)N/C=C\c3ccc(cc3)O[C@@]1([H])CCN2C(=O)[C@@H](NC(=O)/C(C)=N\O)C(C)C |
| InChI | InChI=1S/C30H35N5O6/c1-18(2)25(33-27(36)19(3)34-40)30(39)35-16-14-24-26(35)29(38)32-23(17-21-7-5-4-6-8-21)28(37)31-15-13-20-9-11-22(41-24)12-10-20/h4-13,15,18,23-26,40H,14,16-17H2,1-3H3,(H,31,37)(H,32,38)(H,33,36)/b15-13-,34-19-/t23-,24-,25-,26-/m0/s1 |
| InChIKey | FADRDHDLIJSOGO-NVGWCTLGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ziziphus apetala (ncbitaxon:478035) | stem (BTO:0001300) | PubMed (22148241) | 95% EtOH extract of Air-dried and powdered stems |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Apetaline A (CHEBI:69161) has role metabolite (CHEBI:25212) |
| Apetaline A (CHEBI:69161) is a cyclic peptide (CHEBI:23449) |
| Citations |
|---|