EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H50O7 |
| Net Charge | 0 |
| Average Mass | 546.745 |
| Monoisotopic Mass | 546.35565 |
| SMILES | CC(=O)O[C@@]1(C)CC[C@H](O)C(C)(C)[C@@H]1CC/C(C)=C/C[C@@H](O)/C=C(\C)C(=O)C[C@H]1C(C)(C)C(=O)C=C[C@]1(C)O |
| InChI | InChI=1S/C32H50O7/c1-20(11-13-25-29(4,5)28(37)15-17-32(25,9)39-22(3)33)10-12-23(34)18-21(2)24(35)19-26-30(6,7)27(36)14-16-31(26,8)38/h10,14,16,18,23,25-26,28,34,37-38H,11-13,15,17,19H2,1-9H3/b20-10+,21-18+/t23-,25+,26+,28+,31+,32+/m1/s1 |
| InChIKey | OAMZYQFNMGCDQI-GJBZLVSMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lipastrotethya (WORMS:165681) | - | PubMed (22148280) | MeOH extract of lyophilized and macerated specimen |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pouogenin E (CHEBI:69159) has role metabolite (CHEBI:25212) |
| pouogenin E (CHEBI:69159) is a triterpenoid (CHEBI:36615) |
| Citations |
|---|