EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H54O8 |
| Net Charge | 0 |
| Average Mass | 590.798 |
| Monoisotopic Mass | 590.38187 |
| SMILES | CC(=O)O[C@@H](C[C@H]1C(C)(C)C(=O)C=C[C@]1(C)O)/C(C)=C/[C@H](O)C/C=C(\C)CC[C@H]1C(C)(C)[C@@H](O)CC[C@]1(C)OC(C)=O |
| InChI | InChI=1S/C34H54O8/c1-21(12-14-27-31(5,6)30(39)16-18-34(27,10)42-24(4)36)11-13-25(37)19-22(2)26(41-23(3)35)20-28-32(7,8)29(38)15-17-33(28,9)40/h11,15,17,19,25-28,30,37,39-40H,12-14,16,18,20H2,1-10H3/b21-11+,22-19+/t25-,26+,27+,28+,30+,33+,34+/m1/s1 |
| InChIKey | XYFCCKLZJPBWMV-YOOAOJBASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lipastrotethya (WORMS:165681) | - | PubMed (22148280) | MeOH extract of lyophilized and macerated specimen |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pouogenin D (CHEBI:69157) has role metabolite (CHEBI:25212) |
| pouogenin D (CHEBI:69157) is a triterpenoid (CHEBI:36615) |
| Citations |
|---|