EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H54O7 |
| Net Charge | 0 |
| Average Mass | 574.799 |
| Monoisotopic Mass | 574.38695 |
| SMILES | CC(=O)O[C@@H](C[C@@H]1C(C)=CCC(=O)C1(C)C)/C(C)=C/[C@H](O)C/C=C(\C)CC[C@H]1C(C)(C)[C@@H](O)CC[C@]1(C)OC(C)=O |
| InChI | InChI=1S/C34H54O7/c1-21(12-15-29-33(8,9)31(39)17-18-34(29,10)41-25(5)36)11-14-26(37)19-23(3)28(40-24(4)35)20-27-22(2)13-16-30(38)32(27,6)7/h11,13,19,26-29,31,37,39H,12,14-18,20H2,1-10H3/b21-11+,23-19+/t26-,27-,28+,29+,31+,34+/m1/s1 |
| InChIKey | PTJLIXKRHKJPSE-FJZBMYBNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lipastrotethya (WORMS:165681) | - | PubMed (22148280) | MeOH extract of lyophilized and macerated specimen |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pouogenin C (CHEBI:69155) has role metabolite (CHEBI:25212) |
| pouogenin C (CHEBI:69155) is a triterpenoid (CHEBI:36615) |
| Citations |
|---|