EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H56O8 |
| Net Charge | 0 |
| Average Mass | 616.836 |
| Monoisotopic Mass | 616.39752 |
| SMILES | CC(=O)O[C@@H](C[C@@H]1C(C)=CCC(=O)C1(C)C)/C(C)=C/[C@@H](C/C=C(\C)CC[C@H]1C(C)(C)[C@@H](O)CC[C@]1(C)OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C36H56O8/c1-22(13-16-31-35(9,10)33(41)18-19-36(31,11)44-27(6)39)12-15-28(42-25(4)37)20-24(3)30(43-26(5)38)21-29-23(2)14-17-32(40)34(29,7)8/h12,14,20,28-31,33,41H,13,15-19,21H2,1-11H3/b22-12+,24-20+/t28-,29-,30+,31+,33+,36+/m1/s1 |
| InChIKey | LOUNPPZOBFGBQD-MQQGKSLRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lipastrotethya (WORMS:165681) | - | PubMed (22148280) | MeOH extract of lyophilized and macerated specimen |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pouogenin B (CHEBI:69154) has role metabolite (CHEBI:25212) |
| pouogenin B (CHEBI:69154) is a triterpenoid (CHEBI:36615) |
| Citations |
|---|