EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H52O6 |
| Net Charge | 0 |
| Average Mass | 532.762 |
| Monoisotopic Mass | 532.37639 |
| SMILES | CC(=O)O[C@@]1(C)CC[C@H](O)C(C)(C)[C@@H]1CC/C(C)=C/C[C@@H](O)/C=C(\C)[C@@H](O)C[C@@H]1C(C)=CCC(=O)C1(C)C |
| InChI | InChI=1S/C32H52O6/c1-20(11-14-27-31(7,8)29(37)16-17-32(27,9)38-23(4)33)10-13-24(34)18-22(3)26(35)19-25-21(2)12-15-28(36)30(25,5)6/h10,12,18,24-27,29,34-35,37H,11,13-17,19H2,1-9H3/b20-10+,22-18+/t24-,25-,26+,27+,29+,32+/m1/s1 |
| InChIKey | OWTUXEJSNHQPGD-UMZIEWCISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lipastrotethya (WORMS:165681) | - | PubMed (22148280) | MeOH extract of lyophilized and macerated specimen |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pouogenin A (CHEBI:69153) has role metabolite (CHEBI:25212) |
| pouogenin A (CHEBI:69153) is a triterpenoid (CHEBI:36615) |
| Citations |
|---|