EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H28O3 |
| Net Charge | 0 |
| Average Mass | 280.408 |
| Monoisotopic Mass | 280.20384 |
| SMILES | COC(CC1=CC[C@]2(C)[C@@H](C)CCC[C@]2(C)C1=O)OC |
| InChI | InChI=1S/C17H28O3/c1-12-7-6-9-17(3)15(18)13(8-10-16(12,17)2)11-14(19-4)20-5/h8,12,14H,6-7,9-11H2,1-5H3/t12-,16+,17+/m0/s1 |
| InChIKey | IDSAEMFQCPUIHH-JCURWCKSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cacospongia mycofijiensis (ncbitaxon:1162744) | - | PubMed (22129061) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aignopsane ketal (CHEBI:69142) has role metabolite (CHEBI:25212) |
| aignopsane ketal (CHEBI:69142) is a enol ether (CHEBI:47985) |
| aignopsane ketal (CHEBI:69142) is a enone (CHEBI:51689) |
| Citations |
|---|