EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H44O8 |
| Net Charge | 0 |
| Average Mass | 544.685 |
| Monoisotopic Mass | 544.30362 |
| SMILES | [H][C@]12CC=C[C@@]([H])(C/C=C\C(=O)O[C@H]3C[C@@]([H])(O[C@@]3(/C=C/[C@@H]3CC(C)=CCO3)OC)[C@@H](O)[C@@H](O)CC(=C)C[C@H](C)C1)O2 |
| InChI | InChI=1S/C31H44O8/c1-20-12-14-36-24(16-20)11-13-31(35-4)28-19-27(39-31)30(34)26(32)18-22(3)15-21(2)17-25-9-5-7-23(37-25)8-6-10-29(33)38-28/h5-7,10-13,21,23-28,30,32,34H,3,8-9,14-19H2,1-2,4H3/b10-6-,13-11+/t21-,23-,24+,25-,26-,27+,28-,30-,31+/m0/s1 |
| InChIKey | SZVPVYZZKFBESC-ROKXZQSJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cacospongia mycofijiensis (ncbitaxon:1162744) | - | PubMed (22129061) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 20-methoxy-fijianolide A (CHEBI:69141) has role metabolite (CHEBI:25212) |
| 20-methoxy-fijianolide A (CHEBI:69141) is a macrolide (CHEBI:25106) |
| Citations |
|---|