EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24O4 |
| Net Charge | 0 |
| Average Mass | 268.353 |
| Monoisotopic Mass | 268.16746 |
| SMILES | [H][C@@]1(C(O)C(=O)O)CC[C@]2(C)[C@@H](C)CCC[C@]2(C)C1=O |
| InChI | InChI=1S/C15H24O4/c1-9-5-4-7-15(3)12(17)10(11(16)13(18)19)6-8-14(9,15)2/h9-11,16H,4-8H2,1-3H3,(H,18,19)/t9-,10-,11?,14+,15+/m0/s1 |
| InChIKey | IAEQYZWSXCQPFB-CMZIHQLMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cacospongia mycofijiensis (ncbitaxon:1162744) | - | PubMed (22129061) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aignopsanoic acid B (CHEBI:69139) has role metabolite (CHEBI:25212) |
| aignopsanoic acid B (CHEBI:69139) is a cyclohexanones (CHEBI:23482) |
| Citations |
|---|