EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H32N2O3S |
| Net Charge | 0 |
| Average Mass | 404.576 |
| Monoisotopic Mass | 404.21336 |
| SMILES | C=CC/C=C/Cc1csc(C(C)(C)[C@H](O)C/C=C\C(=C)CCNC(=O)OC)n1 |
| InChI | InChI=1S/C22H32N2O3S/c1-6-7-8-9-12-18-16-28-20(24-18)22(3,4)19(25)13-10-11-17(2)14-15-23-21(26)27-5/h6,8-11,16,19,25H,1-2,7,12-15H2,3-5H3,(H,23,26)/b9-8+,11-10-/t19-/m1/s1 |
| InChIKey | WOVFSYAJXQSJES-BFJIOXTGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cacospongia mycofijiensis (ncbitaxon:1162744) | - | PubMed (22129061) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mycothiazole (CHEBI:69137) has role metabolite (CHEBI:25212) |
| mycothiazole (CHEBI:69137) is a thiazoles (CHEBI:48901) |
| Synonym | Source |
|---|---|
| Carbamic acid, ((4Z,7R)-8-(4-((2Z)-2,5-hexadienyl)-2-thiazolyl)-7-hydroxy-8-methyl-3-methylene-4-nonenyl)-,methyl ester | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:114582-75-1 | ChemIDplus |
| Citations |
|---|