EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H42O7 |
| Net Charge | 0 |
| Average Mass | 514.659 |
| Monoisotopic Mass | 514.29305 |
| SMILES | [H][C@]12CC=C[C@@]([H])(C/C=C\C(=O)O[C@H]([C@@H](O)/C=C/[C@]3([H])CC(C)=CCO3)C[C@]3([H])O[C@@]3([H])[C@@H](O)CC(=C)C[C@H](C)C1)O2 |
| InChI | InChI=1S/C30H42O7/c1-19-12-13-34-23(15-19)10-11-25(31)27-18-28-30(37-28)26(32)17-21(3)14-20(2)16-24-8-4-6-22(35-24)7-5-9-29(33)36-27/h4-6,9-12,20,22-28,30-32H,3,7-8,13-18H2,1-2H3/b9-5-,11-10+/t20-,22-,23+,24-,25-,26-,27-,28-,30-/m0/s1 |
| InChIKey | MSBQEQDLFWWWMV-XZZGLLCESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cacospongia mycofijiensis (ncbitaxon:1162744) | - | DOI (10.1021/jo00250a052) | Species also known as Spongia mycofijiensis. |
| Fasciospongia rimosa (ncbitaxon:572251) | - | DOI (10.1021/ja0027416) | |
| Hyattella Sp. (ncbitaxon:436463) | - | DOI (10.1021/ja0027416) |
| Roles Classification |
|---|
| Biological Roles: | antimitotic Any compound that inhibits cell division (mitosis). microtubule-stabilising agent Any substance that interacts with tubulin to promote polymerisation of microtubules. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| laulimalide (CHEBI:69134) has role animal metabolite (CHEBI:75767) |
| laulimalide (CHEBI:69134) has role antimitotic (CHEBI:64911) |
| laulimalide (CHEBI:69134) has role antineoplastic agent (CHEBI:35610) |
| laulimalide (CHEBI:69134) has role marine metabolite (CHEBI:76507) |
| laulimalide (CHEBI:69134) has role microtubule-stabilising agent (CHEBI:61950) |
| laulimalide (CHEBI:69134) is a carboxylic ester (CHEBI:33308) |
| laulimalide (CHEBI:69134) is a epoxide (CHEBI:32955) |
| laulimalide (CHEBI:69134) is a macrolide (CHEBI:25106) |
| laulimalide (CHEBI:69134) is a secondary alcohol (CHEBI:35681) |
| laulimalide (CHEBI:69134) is a secondary allylic alcohol (CHEBI:134396) |
| IUPAC Name |
|---|
| (1R,3S,7S,8S,10S,12S,15Z,18R)-7-hydroxy-12-{(1S,2E)-1-hydroxy-3-[(2S)-4-methyl-3,6-dihydro-2H-pyran-2-yl]prop-2-en-1-yl}-3-methyl-5-methylidene-9,13,22-trioxatricyclo[16.3.1.08,10]docosa-15,19-dien-14-one |
| Synonyms | Source |
|---|---|
| (1R,3S,7S,8S,10S,12S,15Z,18R)-12-[(1S,2E)-3-[(2S)-3,6-dihydro-4-methyl-2H-pyran-2-yl]-1-hydroxy-2-propen-1-yl]-7-hydroxy-3-methyl-5-methylene-9,13,22-trioxatricyclo[16.3.1.08,10]docosa-15,19-dien-14-one | ChEBI |
| fijianolide B | ChEBI |
| (−)-laulimalide | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00044855 | KNApSAcK |
| WO2008112799 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:115268-43-4 | ChEBI |
| Citations |
|---|