EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H24O3 |
| Net Charge | 0 |
| Average Mass | 264.365 |
| Monoisotopic Mass | 264.17254 |
| SMILES | COC(=O)/C=C1/CC[C@]2(C)[C@@H](C)CCC[C@]2(C)C1=O |
| InChI | InChI=1S/C16H24O3/c1-11-6-5-8-16(3)14(18)12(10-13(17)19-4)7-9-15(11,16)2/h10-11H,5-9H2,1-4H3/b12-10-/t11-,15+,16+/m0/s1 |
| InChIKey | CJQOKVDQHHONIF-USYVDOKNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cacospongia mycofijiensis (ncbitaxon:1162744) | - | PubMed (22129061) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl aignopsanoate (CHEBI:69133) has role metabolite (CHEBI:25212) |
| methyl aignopsanoate (CHEBI:69133) is a cyclohexanones (CHEBI:23482) |
| Synonym | Source |
|---|---|
| (2Z)-2-[(4aR,5S,8aS)-4a,5,8a-trimethyl-1-oxo-3,4,5,6,7,8-hexahydronaphthalen-2-ylidene]acetate | ChEBI |
| Citations |
|---|