EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13NO3 |
| Net Charge | 0 |
| Average Mass | 195.218 |
| Monoisotopic Mass | 195.08954 |
| SMILES | C[C@](N)(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C10H13NO3/c1-10(11,9(13)14)6-7-2-4-8(12)5-3-7/h2-5,12H,6,11H2,1H3,(H,13,14)/t10-/m0/s1 |
| InChIKey | NHTGHBARYWONDQ-JTQLQIEISA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | EC 1.14.16.2 (tyrosine 3-monooxygenase) inhibitor An EC 1.14.16.* (oxidoreductase acting on paired donors, reduced pteridine as one donor, incorporating 1 atom of oxygen) inhibitor that interferes with the action of tyrosine 3-monooxygenase (EC 1.14.16.2). |
| Application: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-methyl-L-tyrosine (CHEBI:6912) has role antihypertensive agent (CHEBI:35674) |
| α-methyl-L-tyrosine (CHEBI:6912) has role EC 1.14.16.2 (tyrosine 3-monooxygenase) inhibitor (CHEBI:63932) |
| α-methyl-L-tyrosine (CHEBI:6912) is a L-tyrosine derivative (CHEBI:27177) |
| α-methyl-L-tyrosine (CHEBI:6912) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| IUPAC Name |
|---|
| α-methyl-L-tyrosine |
| INNs | Source |
|---|---|
| metirosina | ChemIDplus |
| metirosine | KEGG DRUG |
| metirosinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (-)-alpha-Methyl-L-tyrosine | ChemIDplus |
| alpha-Methyltyrosine | ChemIDplus |
| L-alpha-Methyltyrosine | ChemIDplus |
| Methyltyrosine | DrugBank |
| Metyrosine | KEGG COMPOUND |
| (S)-alpha-Methyltyrosine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1792 | DrugCentral |
| C07921 | KEGG COMPOUND |
| D00762 | KEGG DRUG |
| DB00765 | DrugBank |
| Metirosine | Wikipedia |
| US2011104765 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2368400 | Reaxys |
| CAS:672-87-7 | KEGG COMPOUND |
| CAS:672-87-7 | ChemIDplus |
| Citations |
|---|