EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H36O4 |
| Net Charge | 0 |
| Average Mass | 424.581 |
| Monoisotopic Mass | 424.26136 |
| SMILES | [H][C@@]12CC=C3C=CC(=O)[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)[C@@]1([H])CC(C)=C(CO)C(=O)O1 |
| InChI | InChI=1S/C27H36O4/c1-15-13-23(31-25(30)19(15)14-28)16(2)20-8-9-21-18-7-5-17-6-10-24(29)27(17,4)22(18)11-12-26(20,21)3/h5-6,10,16,18,20-23,28H,7-9,11-14H2,1-4H3/t16-,18-,20+,21-,22-,23+,26+,27-/m0/s1 |
| InChIKey | IBYXDWNHLOGYIN-OSVRZWSTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Physalis longifolia (ncbitaxon:161495) | aerial part (BTO:0001658) | PubMed (22098611) | CH2Cl2-MeOH(1:1) extract of the air-dried aerial parts |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| withalongolide F (CHEBI:69111) has role metabolite (CHEBI:25212) |
| withalongolide F (CHEBI:69111) has role plant metabolite (CHEBI:76924) |
| withalongolide F (CHEBI:69111) is a steroid lactone (CHEBI:26766) |
| withalongolide F (CHEBI:69111) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| (6R)-6-{(1S)-1-[(1R,3aS,3bS,8aR,8bS,10aS)-8a,10a-dimethyl-8-oxo-1,2,3,3a,3b,4,8,8a,8b,9,10,10a-dodecahydrodicyclopenta[a,f]naphthalen-1-yl]ethyl}-3-(hydroxymethyl)-4-methyl-5,6-dihydro-2H-pyran-2-one |
| Synonym | Source |
|---|---|
| nor-27-hydroxy-1-oxowitha-2,5,24-trienolide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22217706 | Reaxys |
| Citations |
|---|