EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H34O3 |
| Net Charge | 0 |
| Average Mass | 346.511 |
| Monoisotopic Mass | 346.25079 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@](CC1=C)(C2)[C@H](O)C[C@]1([H])[C@@](C)(COC(C)=O)CCC[C@]13C |
| InChI | InChI=1S/C22H34O3/c1-14-11-22-12-16(14)6-7-17(22)21(4)9-5-8-20(3,13-25-15(2)23)18(21)10-19(22)24/h16-19,24H,1,5-13H2,2-4H3/t16-,17-,18+,19+,20+,21-,22-/m0/s1 |
| InChIKey | DVQAFABFSBJZIB-NXWUBYMWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Croton tonkinensis (IPNI:343648-1) | leaf (BTO:0000713) | PubMed (22085418) | Methanolic extract of dried leaves |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ent-7alpha-hydroxy-18-acetoxykaur-16-ene (CHEBI:69105) has role metabolite (CHEBI:25212) |
| ent-7alpha-hydroxy-18-acetoxykaur-16-ene (CHEBI:69105) is a kaurane diterpenoid (CHEBI:53666) |
| Citations |
|---|