EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H29FO4 |
| Net Charge | 0 |
| Average Mass | 376.468 |
| Monoisotopic Mass | 376.20499 |
| SMILES | [H][C@@]12CCC3=CC(=O)C=C[C@]3(C)[C@@]1(F)[C@@H](O)C[C@]1(C)[C@@H](C(=O)CO)[C@H](C)C[C@@]21[H] |
| InChI | InChI=1S/C22H29FO4/c1-12-8-16-15-5-4-13-9-14(25)6-7-21(13,3)22(15,23)18(27)10-20(16,2)19(12)17(26)11-24/h6-7,9,12,15-16,18-19,24,27H,4-5,8,10-11H2,1-3H3/t12-,15+,16+,18+,19-,20+,21+,22+/m1/s1 |
| InChIKey | VWVSBHGCDBMOOT-IIEHVVJPSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| Applications: | antipsoriatic A drug used to treat psoriasis. antipruritic drug A drug, usually applied topically, that relieves pruritus (itching). anti-inflammatory drug A substance that reduces or suppresses inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| desoximetasone (CHEBI:691037) has role anti-inflammatory drug (CHEBI:35472) |
| desoximetasone (CHEBI:691037) has role antipruritic drug (CHEBI:59683) |
| desoximetasone (CHEBI:691037) has role antipsoriatic (CHEBI:50748) |
| desoximetasone (CHEBI:691037) is a 11β-hydroxy steroid (CHEBI:35346) |
| desoximetasone (CHEBI:691037) is a 20-oxo steroid (CHEBI:36885) |
| desoximetasone (CHEBI:691037) is a 21-hydroxy steroid (CHEBI:35344) |
| desoximetasone (CHEBI:691037) is a 3-oxo-Δ1,Δ4-steroid (CHEBI:77166) |
| desoximetasone (CHEBI:691037) is a fluorinated steroid (CHEBI:50830) |
| desoximetasone (CHEBI:691037) is a glucocorticoid (CHEBI:24261) |
| desoximetasone (CHEBI:691037) is a primary α-hydroxy ketone (CHEBI:139590) |
| IUPAC Name |
|---|
| 9-fluoro-11β,21-dihydroxy-16α-methylpregna-1,4-diene-3,20-dione |
| INNs | Source |
|---|---|
| desoximetasona | ChemIDplus |
| desoximetasone | ChemIDplus |
| desoximetasonum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (11β,16α)-9-fluoro-11,21-dihydroxy-16-methylpregna-1,4-diene-3,20-dione | ChEBI |
| 9α-fluoro-16α-methyl-Δ1-corticosterone | ChEBI |
| A-41-304 | ChEMBL |
| A-41304 | ChEMBL |
| desoxymethasone | ChEBI |
| HOE 304 | ChEMBL |
| Brand Names | Source |
|---|---|
| Stiedex | ChEMBL |
| Stiedex lp | ChEMBL |
| Stiedex lpn | ChEMBL |
| Topicort lp | ChEMBL |
| Citations |
|---|