EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O5 |
| Net Charge | 0 |
| Average Mass | 348.439 |
| Monoisotopic Mass | 348.19367 |
| SMILES | [H][C@]12C(C)(C)CCC[C@@]13C(=O)O[C@]2(O)[C@H](O)C1=C[C@@](C)(C=C)CC[C@@]13O |
| InChI | InChI=1S/C20H28O5/c1-5-17(4)9-10-19(23)12(11-17)13(21)20(24)14-16(2,3)7-6-8-18(14,19)15(22)25-20/h5,11,13-14,21,23-24H,1,6-10H2,2-4H3/t13-,14+,17+,18+,19-,20-/m1/s1 |
| InChIKey | XJXDJAQAAAVDCT-RHOFUAETSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Diplodia cupressi (ncbitaxon:400389) | - | PubMed (22124378) | Strain: 261.85CBS |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sphaeropsidin B (CHEBI:69101) has role metabolite (CHEBI:25212) |
| Sphaeropsidin B (CHEBI:69101) is a γ-lactone (CHEBI:37581) |
| Citations |
|---|