EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22O5 |
| Net Charge | 0 |
| Average Mass | 354.402 |
| Monoisotopic Mass | 354.14672 |
| SMILES | COc1cc2oc(-c3ccc(O)cc3O)cc2c(OC)c1CC=C(C)C |
| InChI | InChI=1S/C21H22O5/c1-12(2)5-7-15-18(24-3)11-20-16(21(15)25-4)10-19(26-20)14-8-6-13(22)9-17(14)23/h5-6,8-11,22-23H,7H2,1-4H3 |
| InChIKey | DKVBYQAVNNRVNN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Glycyrrhiza uralensis (ncbitaxon:74613) | root (BTO:0001188) | PubMed (22074222) | Dried and ground roots extracted with supercritical CO2 with 5% EtOH as modifier |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gancaonin I (CHEBI:69099) has parent hydride 1-benzofuran (CHEBI:35260) |
| gancaonin I (CHEBI:69099) has role antibacterial agent (CHEBI:33282) |
| gancaonin I (CHEBI:69099) has role plant metabolite (CHEBI:76924) |
| gancaonin I (CHEBI:69099) is a 1-benzofurans (CHEBI:38830) |
| gancaonin I (CHEBI:69099) is a aromatic ether (CHEBI:35618) |
| gancaonin I (CHEBI:69099) is a resorcinols (CHEBI:33572) |
| IUPAC Name |
|---|
| 4-[4,6-dimethoxy-5-(3-methylbut-2-en-1-yl)-1-benzofuran-2-yl]benzene-1,3-diol |
| Manual Xrefs | Databases |
|---|---|
| HMDB0038756 | HMDB |
| LMPK12160046 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3630169 | Reaxys |
| CAS:126716-36-7 | ChemIDplus |
| Citations |
|---|