EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H24O5 |
| Net Charge | 0 |
| Average Mass | 368.429 |
| Monoisotopic Mass | 368.16237 |
| SMILES | [H][C@@]12COc3cc(OC)c(CC=C(C)C)c(OC)c3[C@]1([H])Oc1cc(O)ccc12 |
| InChI | InChI=1S/C22H24O5/c1-12(2)5-7-15-17(24-3)10-19-20(21(15)25-4)22-16(11-26-19)14-8-6-13(23)9-18(14)27-22/h5-6,8-10,16,22-23H,7,11H2,1-4H3/t16-,22+/m0/s1 |
| InChIKey | ZCGOJWAIXQAUMW-KSFYIVLOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Glycyrrhiza uralensis (ncbitaxon:74613) | root (BTO:0001188) | PubMed (22074222) | Dried and ground roots extracted with supercritical CO2 with 5% EtOH as modifier |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kanzonol P (CHEBI:69097) has functional parent (6aR,11aR)-pterocarpan (CHEBI:73133) |
| kanzonol P (CHEBI:69097) has role plant metabolite (CHEBI:76924) |
| kanzonol P (CHEBI:69097) is a aromatic ether (CHEBI:35618) |
| kanzonol P (CHEBI:69097) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| (6aR,11aR)-1,3-dimethoxy-2-(3-methylbut-2-en-1-yl)-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromen-9-ol |
| Synonyms | Source |
|---|---|
| (6aR,11aR)-9-hydroxy-1,3-dimethoxy-2-prenhylpterocarpan | HMDB |
| 9-hydroxy-1,3-dimethoxy-2-prenylpterocarpan | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0041193 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6827560 | Reaxys |
| Citations |
|---|