EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22O5 |
| Net Charge | 0 |
| Average Mass | 354.402 |
| Monoisotopic Mass | 354.14672 |
| SMILES | [H][C@@]12COc3cc(O)c(CC=C(C)C)c(OC)c3[C@]1([H])Oc1cc(O)ccc12 |
| InChI | InChI=1S/C21H22O5/c1-11(2)4-6-14-16(23)9-18-19(20(14)24-3)21-15(10-25-18)13-7-5-12(22)8-17(13)26-21/h4-5,7-9,15,21-23H,6,10H2,1-3H3/t15-,21+/m0/s1 |
| InChIKey | HCBAFFVITJAXJE-YCRPNKLZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Glycyrrhiza uralensis (ncbitaxon:74613) | root (BTO:0001188) | PubMed (22074222) | Dried and ground roots extracted with supercritical CO2 with 5% EtOH as modifier |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| edudiol (CHEBI:69095) has functional parent (6aR,11aR)-pterocarpan (CHEBI:73133) |
| edudiol (CHEBI:69095) has role plant metabolite (CHEBI:76924) |
| edudiol (CHEBI:69095) is a aromatic ether (CHEBI:35618) |
| edudiol (CHEBI:69095) is a polyphenol (CHEBI:26195) |
| edudiol (CHEBI:69095) is a pterocarpans (CHEBI:26377) |
| IUPAC Name |
|---|
| (6aR,11aR)-1-methoxy-2-(3-methylbut-2-en-1-yl)-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromene-3,9-diol |
| Synonym | Source |
|---|---|
| 3,9-dihydroxy-1-methoxy-2-prenylpterocarpan | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMPK12070095 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22194631 | Reaxys |
| Citations |
|---|