EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22O6 |
| Net Charge | 0 |
| Average Mass | 382.412 |
| Monoisotopic Mass | 382.14164 |
| SMILES | COc1cc(O)c(-c2coc3cc(O)ccc3c2=O)c(OC)c1CC=C(C)C |
| InChI | InChI=1S/C22H22O6/c1-12(2)5-7-15-18(26-3)10-17(24)20(22(15)27-4)16-11-28-19-9-13(23)6-8-14(19)21(16)25/h5-6,8-11,23-24H,7H2,1-4H3 |
| InChIKey | GGWMNTNDTRKETA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Glycyrrhiza uralensis (ncbitaxon:74613) | root (BTO:0001188) | PubMed (22074222) | Dried and ground roots extracted with supercritical CO2 with 5% EtOH as modifier |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| licoricone (CHEBI:69094) has functional parent isoflavone (CHEBI:18220) |
| licoricone (CHEBI:69094) has role antibacterial agent (CHEBI:33282) |
| licoricone (CHEBI:69094) has role plant metabolite (CHEBI:76924) |
| licoricone (CHEBI:69094) is a 4'-methoxyisoflavones (CHEBI:133959) |
| licoricone (CHEBI:69094) is a hydroxyisoflavone (CHEBI:38755) |
| IUPAC Name |
|---|
| 7-hydroxy-3-[6-hydroxy-2,4-dimethoxy-3-(3-methylbut-2-en-1-yl)phenyl]-4H-chromen-4-one |
| Manual Xrefs | Databases |
|---|---|
| LMPK12050069 | LIPID MAPS |
| HMDB0029515 | HMDB |
| C17765 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1356854 | Reaxys |
| CAS:51847-92-8 | KEGG COMPOUND |
| Citations |
|---|