EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20O6 |
| Net Charge | 0 |
| Average Mass | 356.374 |
| Monoisotopic Mass | 356.12599 |
| SMILES | CC1(C)CCc2c(O)ccc(C3COc4cc(O)cc(O)c4C3=O)c2O1 |
| InChI | InChI=1S/C20H20O6/c1-20(2)6-5-12-14(22)4-3-11(19(12)26-20)13-9-25-16-8-10(21)7-15(23)17(16)18(13)24/h3-4,7-8,13,21-23H,5-6,9H2,1-2H3 |
| InChIKey | QYZNGBWQHYNRBM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Glycyrrhiza uralensis (ncbitaxon:74613) | root (BTO:0001188) | PubMed (22074222) | Dried and ground roots extracted with supercritical CO2 with 5% EtOH as modifier |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glyasperin F (CHEBI:69092) has role plant metabolite (CHEBI:76924) |
| glyasperin F (CHEBI:69092) is a 7-hydroxyisoflavones (CHEBI:55465) |
| IUPAC Name |
|---|
| 5,5',7-trihydroxy-2',2'-dimethyl-2,3,3',4'-tetrahydro-2'H,4H-3,8'-bichromen-4-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5457287 | Reaxys |
| Citations |
|---|