EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20O6 |
| Net Charge | 0 |
| Average Mass | 356.374 |
| Monoisotopic Mass | 356.12599 |
| SMILES | CC(C)=CCc1c(O)ccc(C2COc3cc(O)cc(O)c3C2=O)c1O |
| InChI | InChI=1S/C20H20O6/c1-10(2)3-4-13-15(22)6-5-12(19(13)24)14-9-26-17-8-11(21)7-16(23)18(17)20(14)25/h3,5-8,14,21-24H,4,9H2,1-2H3 |
| InChIKey | BAEYWOSUJSUYFI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Glycyrrhiza uralensis (ncbitaxon:74613) | root (BTO:0001188) | PubMed (22074222) | Dried and ground roots extracted with supercritical CO2 with 5% EtOH as modifier |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihydrolicoisoflavone A (CHEBI:69091) has functional parent licoisoflavone A (CHEBI:28620) |
| dihydrolicoisoflavone A (CHEBI:69091) has role antibacterial agent (CHEBI:33282) |
| dihydrolicoisoflavone A (CHEBI:69091) has role plant metabolite (CHEBI:76924) |
| dihydrolicoisoflavone A (CHEBI:69091) is a 7-hydroxyisoflavones (CHEBI:55465) |
| IUPAC Name |
|---|
| 3-[2,4-dihydroxy-3-(3-methylbut-2-en-1-yl)phenyl]-5,7-dihydroxy-2,3-dihydro-4H-chromen-4-one |
| Synonym | Source |
|---|---|
| dihydrolicoisoflavone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10723724 | Reaxys |
| Citations |
|---|