EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H32O6 |
| Net Charge | 0 |
| Average Mass | 440.536 |
| Monoisotopic Mass | 440.21989 |
| SMILES | [H][C@@]12COc3cc4c(c(OC)c3[C@]1([H])Oc1cc(O)c(CCC(C)(C)O)cc12)CCC(C)(C)O4 |
| InChI | InChI=1S/C26H32O6/c1-25(2,28)8-6-14-10-16-17-13-30-21-12-20-15(7-9-26(3,4)32-20)23(29-5)22(21)24(17)31-19(16)11-18(14)27/h10-12,17,24,27-28H,6-9,13H2,1-5H3/t17-,24+/m0/s1 |
| InChIKey | HNUJQUYWDAIHPF-BXKMTCNYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Glycyrrhiza uralensis (ncbitaxon:74613) | root (BTO:0001188) | PubMed (22074222) | Dried and ground roots extracted with supercritical CO2 with 5% EtOH as modifier |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glycycarpan (CHEBI:69090) has role plant metabolite (CHEBI:76924) |
| glycycarpan (CHEBI:69090) is a aromatic ether (CHEBI:35618) |
| glycycarpan (CHEBI:69090) is a phenols (CHEBI:33853) |
| glycycarpan (CHEBI:69090) is a pterocarpans (CHEBI:26377) |
| IUPAC Name |
|---|
| (7aR,12aR)-9-(3-hydroxy-3-methylbutyl)-13-methoxy-3,3-dimethyl-2,3,7a,12a-tetrahydro-1H,7H-[1]benzofuro[3,2-c]pyrano[3,2-g]chromen-10-ol |
| Synonym | Source |
|---|---|
| 9-hydroxy-1-methoxy-8-(3-hydroxy-3-methylbutyl)-6',6'-dimethyl-4',5'-dihydro-[6H]-pyrano[2',3':3,2]-pterocarpan | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22194634 | Reaxys |
| Citations |
|---|