EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20O6 |
| Net Charge | 0 |
| Average Mass | 368.385 |
| Monoisotopic Mass | 368.12599 |
| SMILES | COc1c(CC=C(C)C)c(O)cc2oc(=O)c(-c3ccc(O)cc3O)cc12 |
| InChI | InChI=1S/C21H20O6/c1-11(2)4-6-14-18(24)10-19-16(20(14)26-3)9-15(21(25)27-19)13-7-5-12(22)8-17(13)23/h4-5,7-10,22-24H,6H2,1-3H3 |
| InChIKey | NZYSZZDSYIBYLC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Glycyrrhiza uralensis (ncbitaxon:74613) | root (BTO:0001188) | PubMed (22074222) | Dried and ground roots extracted with supercritical CO2 with 5% EtOH as modifier |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glycycoumarin (CHEBI:69087) has role antispasmodic drug (CHEBI:53784) |
| glycycoumarin (CHEBI:69087) has role plant metabolite (CHEBI:76924) |
| glycycoumarin (CHEBI:69087) is a aromatic ether (CHEBI:35618) |
| glycycoumarin (CHEBI:69087) is a coumarins (CHEBI:23403) |
| glycycoumarin (CHEBI:69087) is a resorcinols (CHEBI:33572) |
| IUPAC Name |
|---|
| 3-(2,4-dihydroxyphenyl)-7-hydroxy-5-methoxy-6-(3-methylbut-2-en-1-yl)-2H-chromen-2-one |
| Synonym | Source |
|---|---|
| 3-(2,4-dihydroxy-phenyl)-7-hydroxy-5-methoxy-6-(3-methyl-but-2-enyl)-1-benzopyran-2-one | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0038225 | HMDB |
| JP2001253823 | Patent |
| LMPK12160018 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5632912 | Reaxys |
| CAS:94805-82-0 | ChemIDplus |
| Citations |
|---|