EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22O6 |
| Net Charge | 0 |
| Average Mass | 382.412 |
| Monoisotopic Mass | 382.14164 |
| SMILES | COc1cc2oc(=O)c(-c3ccc(O)cc3O)cc2c(OC)c1CC=C(C)C |
| InChI | InChI=1S/C22H22O6/c1-12(2)5-7-15-19(26-3)11-20-17(21(15)27-4)10-16(22(25)28-20)14-8-6-13(23)9-18(14)24/h5-6,8-11,23-24H,7H2,1-4H3 |
| InChIKey | FWWGXZYUURXJLK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Glycyrrhiza uralensis (ncbitaxon:74613) | root (BTO:0001188) | PubMed (22074222) | Dried and ground roots extracted with supercritical CO2 with 5% EtOH as modifier |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glycyrin (CHEBI:69086) has role antibacterial agent (CHEBI:33282) |
| glycyrin (CHEBI:69086) has role metabolite (CHEBI:25212) |
| glycyrin (CHEBI:69086) has role plant metabolite (CHEBI:76924) |
| glycyrin (CHEBI:69086) is a aromatic ether (CHEBI:35618) |
| glycyrin (CHEBI:69086) is a coumarins (CHEBI:23403) |
| glycyrin (CHEBI:69086) is a hydroxyisoflavans (CHEBI:76250) |
| IUPAC Name |
|---|
| 3-(2,4-dihydroxyphenyl)-5,7-dimethoxy-6-(3-methylbut-2-en-1-yl)-2H-chromen-2-one |
| Synonyms | Source |
|---|---|
| 3-(2',4'-dihydroxyphenyl)-5,7-dimethoxy-2-isopentenylcoumarin | ChEBI |
| 3-(2,4-dihydroxyphenyl)-5,7-dimethoxy-6-(3-methyl-but-2-enyl)-1-benzopyran-2-one | ChemIDplus |
| 3-(2,4-dihydroxyphenyl)-5,7-dimethoxy-6-prenylcoumarin | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| HMDB0033712 | HMDB |
| LMPK12160017 | LIPID MAPS |
| WO2004064830 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1667250 | Reaxys |
| CAS:66056-18-6 | ChemIDplus |
| Citations |
|---|