EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22O6 |
| Net Charge | 0 |
| Average Mass | 382.412 |
| Monoisotopic Mass | 382.14164 |
| SMILES | COc1cc2oc(=O)c(-c3ccc(O)cc3O)cc2c(OC)c1CC=C(C)C |
| InChI | InChI=1S/C22H22O6/c1-12(2)5-7-15-19(26-3)11-20-17(21(15)27-4)10-16(22(25)28-20)14-8-6-13(23)9-18(14)24/h5-6,8-11,23-24H,7H2,1-4H3 |
| InChIKey | FWWGXZYUURXJLK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Glycyrrhiza uralensis (ncbitaxon:74613) | root (BTO:0001188) | PubMed (22074222) | Dried and ground roots extracted with supercritical CO2 with 5% EtOH as modifier |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glycyrin (CHEBI:69086) has role antibacterial agent (CHEBI:33282) |
| glycyrin (CHEBI:69086) has role metabolite (CHEBI:25212) |
| glycyrin (CHEBI:69086) has role plant metabolite (CHEBI:76924) |
| glycyrin (CHEBI:69086) is a aromatic ether (CHEBI:35618) |
| glycyrin (CHEBI:69086) is a coumarins (CHEBI:23403) |
| glycyrin (CHEBI:69086) is a hydroxyisoflavans (CHEBI:76250) |
| IUPAC Name |
|---|
| 3-(2,4-dihydroxyphenyl)-5,7-dimethoxy-6-(3-methylbut-2-en-1-yl)-2H-chromen-2-one |
| Synonyms | Source |
|---|---|
| 3-(2',4'-dihydroxyphenyl)-5,7-dimethoxy-2-isopentenylcoumarin | ChEBI |
| 3-(2,4-dihydroxyphenyl)-5,7-dimethoxy-6-(3-methyl-but-2-enyl)-1-benzopyran-2-one | ChemIDplus |
| 3-(2,4-dihydroxyphenyl)-5,7-dimethoxy-6-prenylcoumarin | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| HMDB0033712 | HMDB |
| LMPK12160017 | LIPID MAPS |
| WO2004064830 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1667250 | Reaxys |
| CAS:66056-18-6 | ChemIDplus |
| Citations |
|---|