EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18O6 |
| Net Charge | 0 |
| Average Mass | 354.358 |
| Monoisotopic Mass | 354.11034 |
| SMILES | CC(C)=CCc1cc(-c2coc3cc(O)cc(O)c3c2=O)c(O)cc1O |
| InChI | InChI=1S/C20H18O6/c1-10(2)3-4-11-5-13(16(23)8-15(11)22)14-9-26-18-7-12(21)6-17(24)19(18)20(14)25/h3,5-9,21-24H,4H2,1-2H3 |
| InChIKey | WHPDMWPIFCRONU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Glycyrrhiza uralensis (ncbitaxon:74613) | root (BTO:0001188) | PubMed (22074222) | Dried and ground roots extracted with supercritical CO2 with 5% EtOH as modifier |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| allolicoisoflavone A (CHEBI:69085) has role plant metabolite (CHEBI:76924) |
| allolicoisoflavone A (CHEBI:69085) is a hydroxyisoflavone (CHEBI:38755) |
| IUPAC Name |
|---|
| 3-[2,4-dihydroxy-5-(3-methylbut-2-en-1-yl)phenyl]-5,7-dihydroxy-4H-chromen-4-one |
| Synonym | Source |
|---|---|
| 2',4',5,7-tetrahydroxy-5'-(3-methyl-2-butenyl)isoflavone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5453934 | Reaxys |
| Citations |
|---|