EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26O5 |
| Net Charge | 0 |
| Average Mass | 370.445 |
| Monoisotopic Mass | 370.17802 |
| SMILES | [H][C@@]1(c2ccc(O)cc2O)COc2cc(OC)c(CC=C(C)C)c(OC)c2C1 |
| InChI | InChI=1S/C22H26O5/c1-13(2)5-7-17-20(25-3)11-21-18(22(17)26-4)9-14(12-27-21)16-8-6-15(23)10-19(16)24/h5-6,8,10-11,14,23-24H,7,9,12H2,1-4H3/t14-/m0/s1 |
| InChIKey | DDMAUIOCNQXFHL-AWEZNQCLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Glycyrrhiza uralensis (ncbitaxon:74613) | root (BTO:0001188) | PubMed (22074222) | Dried and ground roots extracted with supercritical CO2 with 5% EtOH as modifier |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glyasperin D (CHEBI:69084) has role plant metabolite (CHEBI:76924) |
| glyasperin D (CHEBI:69084) is a aromatic ether (CHEBI:35618) |
| glyasperin D (CHEBI:69084) is a hydroxyisoflavans (CHEBI:76250) |
| glyasperin D (CHEBI:69084) is a methoxyisoflavan (CHEBI:77002) |
| IUPAC Name |
|---|
| 4-[(3R)-5,7-dimethoxy-6-(3-methylbut-2-en-1-yl)-3,4-dihydro-2H-chromen-3-yl]benzene-1,3-diol |
| Synonym | Source |
|---|---|
| 4-((R)-5,7-dimethoxy-6-(3-methyl-but-2-enyl)-1-benzopyran-3-yl)-benzene-1,3-diol | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5360132 | Reaxys |
| CAS:142561-10-2 | ChemIDplus |
| Citations |
|---|