EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H34O2 |
| Net Charge | 0 |
| Average Mass | 294.479 |
| Monoisotopic Mass | 294.25588 |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OC |
| InChI | InChI=1S/C19H34O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h7-8,10-11H,3-6,9,12-18H2,1-2H3/b8-7-,11-10- |
| InChIKey | WTTJVINHCBCLGX-NQLNTKRDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Neolitsea daibuensis (IPNI:466954-1) | root (BTO:0001188) | PubMed (22148193) | Cold MeOH extract of dried roots |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl linoleate (CHEBI:69080) has functional parent linoleic acid (CHEBI:17351) |
| methyl linoleate (CHEBI:69080) has role plant metabolite (CHEBI:76924) |
| methyl linoleate (CHEBI:69080) is a fatty acid methyl ester (CHEBI:4986) |
| Incoming Relation(s) |
| 13(S)-HPODE methyl ester (CHEBI:78040) has functional parent methyl linoleate (CHEBI:69080) |
| methyl (9R,10E,12Z)-9-hydroperoxyoctadeca-10,12-dienoate (CHEBI:145036) has functional parent methyl linoleate (CHEBI:69080) |
| IUPAC Name |
|---|
| methyl (9Z,12Z)-octadeca-9,12-dienoate |
| Synonyms | Source |
|---|---|
| linoleic acid methyl ester | ChEBI |
| Methyl 9-cis,12-cis-octadecadienoate | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 1-O-methyl-(9Z,12Z)-octadecadienoate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1727614 | Reaxys |
| CAS:112-63-0 | ChemIDplus |
| Citations |
|---|