EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H8Cl3O4P |
| Net Charge | 0 |
| Average Mass | 257.437 |
| Monoisotopic Mass | 255.92258 |
| SMILES | COP(=O)(OC)C(O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C4H8Cl3O4P/c1-10-12(9,11-2)3(8)4(5,6)7/h3,8H,1-2H3 |
| InChIKey | NFACJZMKEDPNKN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 3.1.1.8 (cholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of cholinesterase (EC 3.1.1.8). EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. |
| Applications: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. anthelminthic drug Substance intended to kill parasitic worms (helminths). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trichlorfon (CHEBI:6908) has role agrochemical (CHEBI:33286) |
| trichlorfon (CHEBI:6908) has role anthelminthic drug (CHEBI:35443) |
| trichlorfon (CHEBI:6908) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| trichlorfon (CHEBI:6908) has role EC 3.1.1.8 (cholinesterase) inhibitor (CHEBI:37733) |
| trichlorfon (CHEBI:6908) has role insecticide (CHEBI:24852) |
| trichlorfon (CHEBI:6908) is a organic phosphonate (CHEBI:37592) |
| trichlorfon (CHEBI:6908) is a organochlorine compound (CHEBI:36683) |
| trichlorfon (CHEBI:6908) is a phosphonic ester (CHEBI:37735) |
| IUPAC Name |
|---|
| dimethyl (2,2,2-trichloro-1-hydroxyethyl)phosphonate |
| INNs | Source |
|---|---|
| metrifonate | WHO MedNet |
| métrifonate | WHO MedNet |
| metrifonato | WHO MedNet |
| metrifonatum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1-Hydroxy-2,2,2-trichloroethylphosphonic acid dimethyl ester | ChemIDplus |
| Chlorophos | ChemIDplus |
| Methyl chlorophos | ChemIDplus |
| Metrifonate | KEGG COMPOUND |
| (±)-Trichlorfon | ChemIDplus |
| Trichlorfon | KEGG COMPOUND |
| Citations |
|---|