EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H8Cl3O4P |
| Net Charge | 0 |
| Average Mass | 257.437 |
| Monoisotopic Mass | 255.92258 |
| SMILES | COP(=O)(OC)C(O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C4H8Cl3O4P/c1-10-12(9,11-2)3(8)4(5,6)7/h3,8H,1-2H3 |
| InChIKey | NFACJZMKEDPNKN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. EC 3.1.1.8 (cholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of cholinesterase (EC 3.1.1.8). |
| Applications: | anthelminthic drug Substance intended to kill parasitic worms (helminths). insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trichlorfon (CHEBI:6908) has role agrochemical (CHEBI:33286) |
| trichlorfon (CHEBI:6908) has role anthelminthic drug (CHEBI:35443) |
| trichlorfon (CHEBI:6908) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| trichlorfon (CHEBI:6908) has role EC 3.1.1.8 (cholinesterase) inhibitor (CHEBI:37733) |
| trichlorfon (CHEBI:6908) has role insecticide (CHEBI:24852) |
| trichlorfon (CHEBI:6908) is a organic phosphonate (CHEBI:37592) |
| trichlorfon (CHEBI:6908) is a organochlorine compound (CHEBI:36683) |
| trichlorfon (CHEBI:6908) is a phosphonic ester (CHEBI:37735) |
| IUPAC Name |
|---|
| dimethyl (2,2,2-trichloro-1-hydroxyethyl)phosphonate |
| INNs | Source |
|---|---|
| metrifonato | WHO MedNet |
| metrifonatum | WHO MedNet |
| metrifonate | WHO MedNet |
| métrifonate | WHO MedNet |
| Synonyms | Source |
|---|---|
| Metrifonate | KEGG COMPOUND |
| Trichlorfon | KEGG COMPOUND |
| Chlorophos | ChemIDplus |
| (±)-Trichlorfon | ChemIDplus |
| 1-Hydroxy-2,2,2-trichloroethylphosphonic acid dimethyl ester | ChemIDplus |
| Methyl chlorophos | ChemIDplus |
| Citations |
|---|