EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20O5 |
| Net Charge | 0 |
| Average Mass | 292.331 |
| Monoisotopic Mass | 292.13107 |
| SMILES | C=C[C@]1(C)C[C@]2(O)OC(=O)C(C)=C2C[C@H]1C(=C)C(=O)OC |
| InChI | InChI=1S/C16H20O5/c1-6-15(4)8-16(19)12(10(3)14(18)21-16)7-11(15)9(2)13(17)20-5/h6,11,19H,1-2,7-8H2,3-5H3/t11-,15+,16-/m0/s1 |
| InChIKey | IRKKTJKCMNMSKP-XZJROXQQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Neolitsea daibuensis (IPNI:466954-1) | root (BTO:0001188) | PubMed (22148193) | Cold MeOH extract of dried roots |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sericealactone, (rel)- (CHEBI:69079) has role metabolite (CHEBI:25212) |
| sericealactone, (rel)- (CHEBI:69079) is a terpene lactone (CHEBI:37668) |
| Citations |
|---|